C13H21N3O3S2 — CID 103525531
1-[3-amino-4-methylsulfonyl-5-(piperidin-4-ylamino)thiophen-2-yl]propan-1-one (PubChem CID 103525531) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[3-amino-4-methylsulfonyl-5-(piperidin-4-ylamino)thiophen-2-yl]propan-1-one.
| Compound Name | 1-[3-amino-4-methylsulfonyl-5-(piperidin-4-ylamino)thiophen-2-yl]propan-1-one |
|---|---|
| PubChem CID | 103525531 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-[3-amino-4-methylsulfonyl-5-(piperidin-4-ylamino)thiophen-2-yl]propan-1-one |
| SMILES | CCC(=O)c1sc(NC2CCNCC2)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C13H21N3O3S2/c1-3-9(17)11-10(14)12(21(2,18)19)13(20-11)16-8-4-6-15-7-5-8/h8,15-16H,3-7,14H2,1-2H3 |
| InChIKey | ZZBAHTSVXSKMFJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |