C13H19N3O3S2 — CID 103525965
3-amino-5-(cyclobutylamino)-4-methylsulfonyl-N-prop-2-enylthiophene-2-carboxamide (PubChem CID 103525965) has the molecular formula C13H19N3O3S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 3-amino-5-(cyclobutylamino)-4-methylsulfonyl-N-prop-2-enylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(cyclobutylamino)-4-methylsulfonyl-N-prop-2-enylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103525965 |
| Molecular Formula | C13H19N3O3S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-amino-5-(cyclobutylamino)-4-methylsulfonyl-N-prop-2-enylthiophene-2-carboxamide |
| SMILES | C=CCNC(=O)c1sc(NC2CCC2)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C13H19N3O3S2/c1-3-7-15-12(17)10-9(14)11(21(2,18)19)13(20-10)16-8-5-4-6-8/h3,8,16H,1,4-7,14H2,2H3,(H,15,17) |
| InChIKey | VPLPGWHKIRXHHV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|