C11H15N3O2S2 — CID 103423960
3-amino-5-(cyclopentylamino)-4-methylsulfonylthiophene-2-carbonitrile (PubChem CID 103423960) has the molecular formula C11H15N3O2S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-amino-5-(cyclopentylamino)-4-methylsulfonylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-(cyclopentylamino)-4-methylsulfonylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103423960 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-amino-5-(cyclopentylamino)-4-methylsulfonylthiophene-2-carbonitrile |
| SMILES | CS(=O)(=O)c1c(NC2CCCC2)sc(C#N)c1N |
| InChI | InChI=1S/C11H15N3O2S2/c1-18(15,16)10-9(13)8(6-12)17-11(10)14-7-4-2-3-5-7/h7,14H,2-5,13H2,1H3 |
| InChIKey | LSAROSLKOMPSMV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |