C10H12N4OS — CID 103423667
4-amino-5-cyano-2-(cyclopropylamino)-N-methylthiophene-3-carboxamide (PubChem CID 103423667) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 4-amino-5-cyano-2-(cyclopropylamino)-N-methylthiophene-3-carboxamide.
| Compound Name | 4-amino-5-cyano-2-(cyclopropylamino)-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 103423667 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-amino-5-cyano-2-(cyclopropylamino)-N-methylthiophene-3-carboxamide |
| SMILES | CNC(=O)c1c(NC2CC2)sc(C#N)c1N |
| InChI | InChI=1S/C10H12N4OS/c1-13-9(15)7-8(12)6(4-11)16-10(7)14-5-2-3-5/h5,14H,2-3,12H2,1H3,(H,13,15) |
| InChIKey | WSXIPWLXFNQKSN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |