About 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide
4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide (PubChem CID 103428685) has the molecular formula C11H14N4O3S2
and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide |
| PubChem CID | 103428685 |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide |
| SMILES | N#Cc1sc(NC2CCS(=O)(=O)CC2)c(C(N)=O)c1N |
| InChI | InChI=1S/C11H14N4O3S2/c12-5-7-9(13)8(10(14)16)11(19-7)15-6-1-3-20(17,18)4-2-6/h6,15H,1-4,13H2,(H2,14,16) |
| InChIKey | WYRLGTNLGBKUJB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 139.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide?
The IUPAC name of 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide (CID 103428685) is 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide.
What is the SMILES notation for 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide?
The canonical SMILES for 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide is N#Cc1sc(NC2CCS(=O)(=O)CC2)c(C(N)=O)c1N.
What is the InChIKey of 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide?
The InChIKey is WYRLGTNLGBKUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O3S2/c12-5-7-9(13)8(10(14)16)11(19-7)15-6-1-3-20(17,18)4-2-6/h6,15H,1-4,13H2,(H2,14,16).
What are the key properties of 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide?
4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide has a molecular weight of 314.39 g/mol, XLogP of 0.29, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-cyano-2-[(1,1-dioxothian-4-yl)amino]thiophene-3-carboxamide is sourced from PubChem (CID 103428685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).