C11H16N4O2S — CID 103423923
3-amino-5-(cyclopentylamino)thiophene-2,4-dicarboxamide (PubChem CID 103423923) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 3-amino-5-(cyclopentylamino)thiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-5-(cyclopentylamino)thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 103423923 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-amino-5-(cyclopentylamino)thiophene-2,4-dicarboxamide |
| SMILES | NC(=O)c1sc(NC2CCCC2)c(C(N)=O)c1N |
| InChI | InChI=1S/C11H16N4O2S/c12-7-6(9(13)16)11(18-8(7)10(14)17)15-5-3-1-2-4-5/h5,15H,1-4,12H2,(H2,13,16)(H2,14,17) |
| InChIKey | AQKYYPLEYLVTJB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |