C14H21N3O3S — CID 103424714
4-amino-2-[(4-hydroxycyclohexyl)amino]-5-propanoylthiophene-3-carboxamide (PubChem CID 103424714) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-amino-2-[(4-hydroxycyclohexyl)amino]-5-propanoylthiophene-3-carboxamide.
| Compound Name | 4-amino-2-[(4-hydroxycyclohexyl)amino]-5-propanoylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 103424714 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-amino-2-[(4-hydroxycyclohexyl)amino]-5-propanoylthiophene-3-carboxamide |
| SMILES | CCC(=O)c1sc(NC2CCC(O)CC2)c(C(N)=O)c1N |
| InChI | InChI=1S/C14H21N3O3S/c1-2-9(19)12-11(15)10(13(16)20)14(21-12)17-7-3-5-8(18)6-4-7/h7-8,17-18H,2-6,15H2,1H3,(H2,16,20) |
| InChIKey | WAINCNXQNKXJQM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |