C13H20N4O3S — CID 103508099
ethyl 3-amino-4-carbamoyl-5-[(1-methylpyrrolidin-3-yl)amino]thiophene-2-carboxylate (PubChem CID 103508099) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is ethyl 3-amino-4-carbamoyl-5-[(1-methylpyrrolidin-3-yl)amino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-4-carbamoyl-5-[(1-methylpyrrolidin-3-yl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103508099 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | ethyl 3-amino-4-carbamoyl-5-[(1-methylpyrrolidin-3-yl)amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC2CCN(C)C2)c(C(N)=O)c1N |
| InChI | InChI=1S/C13H20N4O3S/c1-3-20-13(19)10-9(14)8(11(15)18)12(21-10)16-7-4-5-17(2)6-7/h7,16H,3-6,14H2,1-2H3,(H2,15,18) |
| InChIKey | NVVCNBKLYVMCFU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |