C12H16N4O2S — CID 103507608
4-amino-5-cyano-2-(3-methoxypiperidin-1-yl)thiophene-3-carboxamide (PubChem CID 103507608) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-amino-5-cyano-2-(3-methoxypiperidin-1-yl)thiophene-3-carboxamide.
| Compound Name | 4-amino-5-cyano-2-(3-methoxypiperidin-1-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103507608 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-amino-5-cyano-2-(3-methoxypiperidin-1-yl)thiophene-3-carboxamide |
| SMILES | COC1CCCN(c2sc(C#N)c(N)c2C(N)=O)C1 |
| InChI | InChI=1S/C12H16N4O2S/c1-18-7-3-2-4-16(6-7)12-9(11(15)17)10(14)8(5-13)19-12/h7H,2-4,6,14H2,1H3,(H2,15,17) |
| InChIKey | QBTYUHBNANVTEL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 105.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |