C14H21N5OS — CID 103526437
4-amino-5-cyano-2-[4-[(dimethylamino)methyl]piperidin-1-yl]thiophene-3-carboxamide (PubChem CID 103526437) has the molecular formula C14H21N5OS and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-amino-5-cyano-2-[4-[(dimethylamino)methyl]piperidin-1-yl]thiophene-3-carboxamide.
| Compound Name | 4-amino-5-cyano-2-[4-[(dimethylamino)methyl]piperidin-1-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103526437 |
| Molecular Formula | C14H21N5OS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 4-amino-5-cyano-2-[4-[(dimethylamino)methyl]piperidin-1-yl]thiophene-3-carboxamide |
| SMILES | CN(C)CC1CCN(c2sc(C#N)c(N)c2C(N)=O)CC1 |
| InChI | InChI=1S/C14H21N5OS/c1-18(2)8-9-3-5-19(6-4-9)14-11(13(17)20)12(16)10(7-15)21-14/h9H,3-6,8,16H2,1-2H3,(H2,17,20) |
| InChIKey | DLJQVPHOFWWJJQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |