C12H17N3O2S — CID 103507576
3-amino-4-methoxy-5-(3-methoxypiperidin-1-yl)thiophene-2-carbonitrile (PubChem CID 103507576) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-amino-4-methoxy-5-(3-methoxypiperidin-1-yl)thiophene-2-carbonitrile.
| Compound Name | 3-amino-4-methoxy-5-(3-methoxypiperidin-1-yl)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103507576 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-amino-4-methoxy-5-(3-methoxypiperidin-1-yl)thiophene-2-carbonitrile |
| SMILES | COc1c(N2CCCC(OC)C2)sc(C#N)c1N |
| InChI | InChI=1S/C12H17N3O2S/c1-16-8-4-3-5-15(7-8)12-11(17-2)10(14)9(6-13)18-12/h8H,3-5,7,14H2,1-2H3 |
| InChIKey | FFJZKRCMVZNLAP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |