C12H18N4OS — CID 106029415
3-amino-4-methoxy-5-[(1-methylpyrrolidin-2-yl)methylamino]thiophene-2-carbonitrile (PubChem CID 106029415) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is 3-amino-4-methoxy-5-[(1-methylpyrrolidin-2-yl)methylamino]thiophene-2-carbonitrile.
| Compound Name | 3-amino-4-methoxy-5-[(1-methylpyrrolidin-2-yl)methylamino]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 106029415 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-amino-4-methoxy-5-[(1-methylpyrrolidin-2-yl)methylamino]thiophene-2-carbonitrile |
| SMILES | COc1c(NCC2CCCN2C)sc(C#N)c1N |
| InChI | InChI=1S/C12H18N4OS/c1-16-5-3-4-8(16)7-15-12-11(17-2)10(14)9(6-13)18-12/h8,15H,3-5,7,14H2,1-2H3 |
| InChIKey | UYKZDNQWXXBFHB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |