C12H18N4O2S — CID 103426135
3-amino-4-methoxy-5-(2-morpholin-4-ylethylamino)thiophene-2-carbonitrile (PubChem CID 103426135) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-amino-4-methoxy-5-(2-morpholin-4-ylethylamino)thiophene-2-carbonitrile.
| Compound Name | 3-amino-4-methoxy-5-(2-morpholin-4-ylethylamino)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103426135 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-amino-4-methoxy-5-(2-morpholin-4-ylethylamino)thiophene-2-carbonitrile |
| SMILES | COc1c(NCCN2CCOCC2)sc(C#N)c1N |
| InChI | InChI=1S/C12H18N4O2S/c1-17-11-10(14)9(8-13)19-12(11)15-2-3-16-4-6-18-7-5-16/h15H,2-7,14H2,1H3 |
| InChIKey | CLSQTNHEPJTMQR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |