C10H9F3N4OS — CID 106218979
4-amino-5-cyano-2-[[1-(trifluoromethyl)cyclopropyl]amino]thiophene-3-carboxamide (PubChem CID 106218979) has the molecular formula C10H9F3N4OS and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-amino-5-cyano-2-[[1-(trifluoromethyl)cyclopropyl]amino]thiophene-3-carboxamide.
| Compound Name | 4-amino-5-cyano-2-[[1-(trifluoromethyl)cyclopropyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 106218979 |
| Molecular Formula | C10H9F3N4OS |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-amino-5-cyano-2-[[1-(trifluoromethyl)cyclopropyl]amino]thiophene-3-carboxamide |
| SMILES | N#Cc1sc(NC2(C(F)(F)F)CC2)c(C(N)=O)c1N |
| InChI | InChI=1S/C10H9F3N4OS/c11-10(12,13)9(1-2-9)17-8-5(7(16)18)6(15)4(3-14)19-8/h17H,1-2,15H2,(H2,16,18) |
| InChIKey | CPWAEPTWXYGKRK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |