C14H13FN4OS — CID 103427665
4-amino-5-cyano-2-[2-(3-fluorophenyl)ethylamino]thiophene-3-carboxamide (PubChem CID 103427665) has the molecular formula C14H13FN4OS and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-amino-5-cyano-2-[2-(3-fluorophenyl)ethylamino]thiophene-3-carboxamide.
| Compound Name | 4-amino-5-cyano-2-[2-(3-fluorophenyl)ethylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103427665 |
| Molecular Formula | C14H13FN4OS |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-amino-5-cyano-2-[2-(3-fluorophenyl)ethylamino]thiophene-3-carboxamide |
| SMILES | N#Cc1sc(NCCc2cccc(F)c2)c(C(N)=O)c1N |
| InChI | InChI=1S/C14H13FN4OS/c15-9-3-1-2-8(6-9)4-5-19-14-11(13(18)20)12(17)10(7-16)21-14/h1-3,6,19H,4-5,17H2,(H2,18,20) |
| InChIKey | PZOQFTUDGVJGDN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |