C14H13FN4OS — CID 103420730
3-amino-4-cyano-5-[(3-fluorophenyl)methyl-methylamino]thiophene-2-carboxamide (PubChem CID 103420730) has the molecular formula C14H13FN4OS and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-amino-4-cyano-5-[(3-fluorophenyl)methyl-methylamino]thiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyano-5-[(3-fluorophenyl)methyl-methylamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103420730 |
| Molecular Formula | C14H13FN4OS |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-amino-4-cyano-5-[(3-fluorophenyl)methyl-methylamino]thiophene-2-carboxamide |
| SMILES | CN(Cc1cccc(F)c1)c1sc(C(N)=O)c(N)c1C#N |
| InChI | InChI=1S/C14H13FN4OS/c1-19(7-8-3-2-4-9(15)5-8)14-10(6-16)11(17)12(21-14)13(18)20/h2-5H,7,17H2,1H3,(H2,18,20) |
| InChIKey | KHOFRTNOSYBBEE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 96.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |