C15H17N3S2 — CID 103418165
3-amino-5-[methyl-[(3-methylphenyl)methyl]amino]-4-methylsulfanylthiophene-2-carbonitrile (PubChem CID 103418165) has the molecular formula C15H17N3S2 and a molecular weight of 303.46 g/mol. Its IUPAC name is 3-amino-5-[methyl-[(3-methylphenyl)methyl]amino]-4-methylsulfanylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[methyl-[(3-methylphenyl)methyl]amino]-4-methylsulfanylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103418165 |
| Molecular Formula | C15H17N3S2 |
| Molecular Weight | 303.46 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-amino-5-[methyl-[(3-methylphenyl)methyl]amino]-4-methylsulfanylthiophene-2-carbonitrile |
| SMILES | CSc1c(N(C)Cc2cccc(C)c2)sc(C#N)c1N |
| InChI | InChI=1S/C15H17N3S2/c1-10-5-4-6-11(7-10)9-18(2)15-14(19-3)13(17)12(8-16)20-15/h4-7H,9,17H2,1-3H3 |
| InChIKey | ZWVSDJDJIUYKJG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |