C14H16N4S2 — CID 103505484
3-amino-5-[ethyl(pyridin-2-ylmethyl)amino]-4-methylsulfanylthiophene-2-carbonitrile (PubChem CID 103505484) has the molecular formula C14H16N4S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 3-amino-5-[ethyl(pyridin-2-ylmethyl)amino]-4-methylsulfanylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[ethyl(pyridin-2-ylmethyl)amino]-4-methylsulfanylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103505484 |
| Molecular Formula | C14H16N4S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-amino-5-[ethyl(pyridin-2-ylmethyl)amino]-4-methylsulfanylthiophene-2-carbonitrile |
| SMILES | CCN(Cc1ccccn1)c1sc(C#N)c(N)c1SC |
| InChI | InChI=1S/C14H16N4S2/c1-3-18(9-10-6-4-5-7-17-10)14-13(19-2)12(16)11(8-15)20-14/h4-7H,3,9,16H2,1-2H3 |
| InChIKey | CFRIBWKXWQLDQV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |