C11H17N3S2 — CID 103420340
3-amino-5-[butyl(methyl)amino]-4-methylsulfanylthiophene-2-carbonitrile (PubChem CID 103420340) has the molecular formula C11H17N3S2 and a molecular weight of 255.41 g/mol. Its IUPAC name is 3-amino-5-[butyl(methyl)amino]-4-methylsulfanylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[butyl(methyl)amino]-4-methylsulfanylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103420340 |
| Molecular Formula | C11H17N3S2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-amino-5-[butyl(methyl)amino]-4-methylsulfanylthiophene-2-carbonitrile |
| SMILES | CCCCN(C)c1sc(C#N)c(N)c1SC |
| InChI | InChI=1S/C11H17N3S2/c1-4-5-6-14(2)11-10(15-3)9(13)8(7-12)16-11/h4-6,13H2,1-3H3 |
| InChIKey | SVAFAFZBERNDAF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |