C9H13N3O2S2 — CID 103420922
3-amino-5-[ethyl(methyl)amino]-4-methylsulfonylthiophene-2-carbonitrile (PubChem CID 103420922) has the molecular formula C9H13N3O2S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 3-amino-5-[ethyl(methyl)amino]-4-methylsulfonylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[ethyl(methyl)amino]-4-methylsulfonylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103420922 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 3-amino-5-[ethyl(methyl)amino]-4-methylsulfonylthiophene-2-carbonitrile |
| SMILES | CCN(C)c1sc(C#N)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C9H13N3O2S2/c1-4-12(2)9-8(16(3,13)14)7(11)6(5-10)15-9/h4,11H2,1-3H3 |
| InChIKey | MTSNQGIWROTKNA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |