C10H15N3O3S2 — CID 103425081
3-amino-5-(1-methoxypropan-2-ylamino)-4-methylsulfonylthiophene-2-carbonitrile (PubChem CID 103425081) has the molecular formula C10H15N3O3S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-amino-5-(1-methoxypropan-2-ylamino)-4-methylsulfonylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-(1-methoxypropan-2-ylamino)-4-methylsulfonylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103425081 |
| Molecular Formula | C10H15N3O3S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-amino-5-(1-methoxypropan-2-ylamino)-4-methylsulfonylthiophene-2-carbonitrile |
| SMILES | COCC(C)Nc1sc(C#N)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C10H15N3O3S2/c1-6(5-16-2)13-10-9(18(3,14)15)8(12)7(4-11)17-10/h6,13H,5,12H2,1-3H3 |
| InChIKey | LETJVNDYHZFISP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |