C11H18N2O5S2 — CID 103425062
methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-methylsulfonylthiophene-2-carboxylate (PubChem CID 103425062) has the molecular formula C11H18N2O5S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-methylsulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-methylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 103425062 |
| Molecular Formula | C11H18N2O5S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-methylsulfonylthiophene-2-carboxylate |
| SMILES | COCC(C)Nc1sc(C(=O)OC)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C11H18N2O5S2/c1-6(5-17-2)13-10-9(20(4,15)16)7(12)8(19-10)11(14)18-3/h6,13H,5,12H2,1-4H3 |
| InChIKey | MHNOXQLJBSJONS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |