C12H20N2O4S — CID 103425032
ethyl 3-amino-4-methoxy-5-(1-methoxypropan-2-ylamino)thiophene-2-carboxylate (PubChem CID 103425032) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is ethyl 3-amino-4-methoxy-5-(1-methoxypropan-2-ylamino)thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-4-methoxy-5-(1-methoxypropan-2-ylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103425032 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | ethyl 3-amino-4-methoxy-5-(1-methoxypropan-2-ylamino)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(C)COC)c(OC)c1N |
| InChI | InChI=1S/C12H20N2O4S/c1-5-18-12(15)10-8(13)9(17-4)11(19-10)14-7(2)6-16-3/h7,14H,5-6,13H2,1-4H3 |
| InChIKey | OBCWSJZPXDIEEI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |