C11H14F4N2O3S — CID 106296512
ethyl 3-amino-4-methoxy-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxylate (PubChem CID 106296512) has the molecular formula C11H14F4N2O3S and a molecular weight of 330.30 g/mol. Its IUPAC name is ethyl 3-amino-4-methoxy-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-4-methoxy-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 106296512 |
| Molecular Formula | C11H14F4N2O3S |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | ethyl 3-amino-4-methoxy-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NCC(F)(F)C(F)F)c(OC)c1N |
| InChI | InChI=1S/C11H14F4N2O3S/c1-3-20-9(18)7-5(16)6(19-2)8(21-7)17-4-11(14,15)10(12)13/h10,17H,3-4,16H2,1-2H3 |
| InChIKey | JAFWTZOSKYQTGF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|