C10H9F4N3OS — CID 106296531
5-acetyl-4-amino-2-(2,2,3,3-tetrafluoropropylamino)thiophene-3-carbonitrile (PubChem CID 106296531) has the molecular formula C10H9F4N3OS and a molecular weight of 295.26 g/mol. Its IUPAC name is 5-acetyl-4-amino-2-(2,2,3,3-tetrafluoropropylamino)thiophene-3-carbonitrile.
| Compound Name | 5-acetyl-4-amino-2-(2,2,3,3-tetrafluoropropylamino)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 106296531 |
| Molecular Formula | C10H9F4N3OS |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 5-acetyl-4-amino-2-(2,2,3,3-tetrafluoropropylamino)thiophene-3-carbonitrile |
| SMILES | CC(=O)c1sc(NCC(F)(F)C(F)F)c(C#N)c1N |
| InChI | InChI=1S/C10H9F4N3OS/c1-4(18)7-6(16)5(2-15)8(19-7)17-3-10(13,14)9(11)12/h9,17H,3,16H2,1H3 |
| InChIKey | LGYJVNHYJAOZPN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|