C10H9F4N3O2S — CID 106296514
methyl 3-amino-4-cyano-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxylate (PubChem CID 106296514) has the molecular formula C10H9F4N3O2S and a molecular weight of 311.26 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 106296514 |
| Molecular Formula | C10H9F4N3O2S |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | methyl 3-amino-4-cyano-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NCC(F)(F)C(F)F)c(C#N)c1N |
| InChI | InChI=1S/C10H9F4N3O2S/c1-19-8(18)6-5(16)4(2-15)7(20-6)17-3-10(13,14)9(11)12/h9,17H,3,16H2,1H3 |
| InChIKey | POWYVSOBMIIECA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|