C11H13F4N3O2S — CID 106296533
4-amino-5-propanoyl-2-(2,2,3,3-tetrafluoropropylamino)thiophene-3-carboxamide (PubChem CID 106296533) has the molecular formula C11H13F4N3O2S and a molecular weight of 327.30 g/mol. Its IUPAC name is 4-amino-5-propanoyl-2-(2,2,3,3-tetrafluoropropylamino)thiophene-3-carboxamide.
| Compound Name | 4-amino-5-propanoyl-2-(2,2,3,3-tetrafluoropropylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 106296533 |
| Molecular Formula | C11H13F4N3O2S |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 4-amino-5-propanoyl-2-(2,2,3,3-tetrafluoropropylamino)thiophene-3-carboxamide |
| SMILES | CCC(=O)c1sc(NCC(F)(F)C(F)F)c(C(N)=O)c1N |
| InChI | InChI=1S/C11H13F4N3O2S/c1-2-4(19)7-6(16)5(8(17)20)9(21-7)18-3-11(14,15)10(12)13/h10,18H,2-3,16H2,1H3,(H2,17,20) |
| InChIKey | WRYCECNDVIFZQQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|