C9H8F4N4OS — CID 106296507
3-amino-4-cyano-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxamide (PubChem CID 106296507) has the molecular formula C9H8F4N4OS and a molecular weight of 296.25 g/mol. Its IUPAC name is 3-amino-4-cyano-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyano-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106296507 |
| Molecular Formula | C9H8F4N4OS |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-amino-4-cyano-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxamide |
| SMILES | N#Cc1c(NCC(F)(F)C(F)F)sc(C(N)=O)c1N |
| InChI | InChI=1S/C9H8F4N4OS/c10-8(11)9(12,13)2-17-7-3(1-14)4(15)5(19-7)6(16)18/h8,17H,2,15H2,(H2,16,18) |
| InChIKey | KSHACKLWJXRISI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|