C13H19N5OS — CID 103508485
3-amino-4-cyano-5-(1-pyrrolidin-1-ylpropan-2-ylamino)thiophene-2-carboxamide (PubChem CID 103508485) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 3-amino-4-cyano-5-(1-pyrrolidin-1-ylpropan-2-ylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyano-5-(1-pyrrolidin-1-ylpropan-2-ylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103508485 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-amino-4-cyano-5-(1-pyrrolidin-1-ylpropan-2-ylamino)thiophene-2-carboxamide |
| SMILES | CC(CN1CCCC1)Nc1sc(C(N)=O)c(N)c1C#N |
| InChI | InChI=1S/C13H19N5OS/c1-8(7-18-4-2-3-5-18)17-13-9(6-14)10(15)11(20-13)12(16)19/h8,17H,2-5,7,15H2,1H3,(H2,16,19) |
| InChIKey | RSTAZFYVJBOOHK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |