C11H12N6OS — CID 103507784
3-amino-4-cyano-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxamide (PubChem CID 103507784) has the molecular formula C11H12N6OS and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-amino-4-cyano-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyano-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103507784 |
| Molecular Formula | C11H12N6OS |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 3-amino-4-cyano-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxamide |
| SMILES | Cn1cc(CNc2sc(C(N)=O)c(N)c2C#N)cn1 |
| InChI | InChI=1S/C11H12N6OS/c1-17-5-6(4-16-17)3-15-11-7(2-12)8(13)9(19-11)10(14)18/h4-5,15H,3,13H2,1H3,(H2,14,18) |
| InChIKey | ZTVCSJXHHFDQOK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |