C11H15N5O3S2 — CID 103507837
3-amino-5-[(1-methylpyrazol-4-yl)methylamino]-4-methylsulfonylthiophene-2-carboxamide (PubChem CID 103507837) has the molecular formula C11H15N5O3S2 and a molecular weight of 329.41 g/mol. Its IUPAC name is 3-amino-5-[(1-methylpyrazol-4-yl)methylamino]-4-methylsulfonylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[(1-methylpyrazol-4-yl)methylamino]-4-methylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103507837 |
| Molecular Formula | C11H15N5O3S2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 3-amino-5-[(1-methylpyrazol-4-yl)methylamino]-4-methylsulfonylthiophene-2-carboxamide |
| SMILES | Cn1cc(CNc2sc(C(N)=O)c(N)c2S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C11H15N5O3S2/c1-16-5-6(4-15-16)3-14-11-9(21(2,18)19)7(12)8(20-11)10(13)17/h4-5,14H,3,12H2,1-2H3,(H2,13,17) |
| InChIKey | MHPNQNDVFGKVJR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |