C11H15N5OS — CID 103507791
3-amino-N-methyl-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxamide (PubChem CID 103507791) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is 3-amino-N-methyl-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxamide.
| Compound Name | 3-amino-N-methyl-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103507791 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-amino-N-methyl-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc(NCc2cnn(C)c2)cc1N |
| InChI | InChI=1S/C11H15N5OS/c1-13-11(17)10-8(12)3-9(18-10)14-4-7-5-15-16(2)6-7/h3,5-6,14H,4,12H2,1-2H3,(H,13,17) |
| InChIKey | ISNMFQBEUDSULK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |