C11H19N3OS — CID 103424129
3-amino-N-methyl-5-(pentan-3-ylamino)thiophene-2-carboxamide (PubChem CID 103424129) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 3-amino-N-methyl-5-(pentan-3-ylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-methyl-5-(pentan-3-ylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103424129 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-amino-N-methyl-5-(pentan-3-ylamino)thiophene-2-carboxamide |
| SMILES | CCC(CC)Nc1cc(N)c(C(=O)NC)s1 |
| InChI | InChI=1S/C11H19N3OS/c1-4-7(5-2)14-9-6-8(12)10(16-9)11(15)13-3/h6-7,14H,4-5,12H2,1-3H3,(H,13,15) |
| InChIKey | YPSLBNVDSOJKAU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |