C10H14F3N3OS — CID 103505964
3-amino-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide (PubChem CID 103505964) has the molecular formula C10H14F3N3OS and a molecular weight of 281.30 g/mol. Its IUPAC name is 3-amino-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103505964 |
| Molecular Formula | C10H14F3N3OS |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-amino-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc(NCCCC(F)(F)F)cc1N |
| InChI | InChI=1S/C10H14F3N3OS/c1-15-9(17)8-6(14)5-7(18-8)16-4-2-3-10(11,12)13/h5,16H,2-4,14H2,1H3,(H,15,17) |
| InChIKey | ADMRVXRNRHHTAK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|