C12H14BrN3OS2 — CID 106045453
3-amino-5-[2-(5-bromothiophen-2-yl)ethylamino]-N-methylthiophene-2-carboxamide (PubChem CID 106045453) has the molecular formula C12H14BrN3OS2 and a molecular weight of 360.30 g/mol. Its IUPAC name is 3-amino-5-[2-(5-bromothiophen-2-yl)ethylamino]-N-methylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[2-(5-bromothiophen-2-yl)ethylamino]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 106045453 |
| Molecular Formula | C12H14BrN3OS2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 3-amino-5-[2-(5-bromothiophen-2-yl)ethylamino]-N-methylthiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc(NCCc2ccc(Br)s2)cc1N |
| InChI | InChI=1S/C12H14BrN3OS2/c1-15-12(17)11-8(14)6-10(19-11)16-5-4-7-2-3-9(13)18-7/h2-3,6,16H,4-5,14H2,1H3,(H,15,17) |
| InChIKey | JKFVTJAVZFGDGI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |