C13H14BrN3OS — CID 106033536
2,4-diamino-N-[2-(5-bromothiophen-2-yl)ethyl]benzamide (PubChem CID 106033536) has the molecular formula C13H14BrN3OS and a molecular weight of 340.25 g/mol. Its IUPAC name is 2,4-diamino-N-[2-(5-bromothiophen-2-yl)ethyl]benzamide.
| Compound Name | 2,4-diamino-N-[2-(5-bromothiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 106033536 |
| Molecular Formula | C13H14BrN3OS |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2,4-diamino-N-[2-(5-bromothiophen-2-yl)ethyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCCc2ccc(Br)s2)c(N)c1 |
| InChI | InChI=1S/C13H14BrN3OS/c14-12-4-2-9(19-12)5-6-17-13(18)10-3-1-8(15)7-11(10)16/h1-4,7H,5-6,15-16H2,(H,17,18) |
| InChIKey | BPHJGOTYMMMHBQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|