C13H13BrN2O2S — CID 106039782
2-amino-4-[2-(5-bromothiophen-2-yl)ethylamino]benzoic acid (PubChem CID 106039782) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is 2-amino-4-[2-(5-bromothiophen-2-yl)ethylamino]benzoic acid.
| Compound Name | 2-amino-4-[2-(5-bromothiophen-2-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 106039782 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2-amino-4-[2-(5-bromothiophen-2-yl)ethylamino]benzoic acid |
| SMILES | Nc1cc(NCCc2ccc(Br)s2)ccc1C(=O)O |
| InChI | InChI=1S/C13H13BrN2O2S/c14-12-4-2-9(19-12)5-6-16-8-1-3-10(13(17)18)11(15)7-8/h1-4,7,16H,5-6,15H2,(H,17,18) |
| InChIKey | FOWQPNWNJASFSR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|