C9H12N2O3 — CID 175322504
2-amino-4-(2-hydroxyethylamino)benzoic acid (PubChem CID 175322504) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-amino-4-(2-hydroxyethylamino)benzoic acid.
| Compound Name | 2-amino-4-(2-hydroxyethylamino)benzoic acid |
|---|---|
| PubChem CID | 175322504 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-amino-4-(2-hydroxyethylamino)benzoic acid |
| SMILES | Nc1cc(NCCO)ccc1C(=O)O |
| InChI | InChI=1S/C9H12N2O3/c10-8-5-6(11-3-4-12)1-2-7(8)9(13)14/h1-2,5,11-12H,3-4,10H2,(H,13,14) |
| InChIKey | JKVHKWQIZPNOMT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|