C13H19N5OS — CID 103509920
3-amino-N-methyl-5-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]thiophene-2-carboxamide (PubChem CID 103509920) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 3-amino-N-methyl-5-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]thiophene-2-carboxamide.
| Compound Name | 3-amino-N-methyl-5-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103509920 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-amino-N-methyl-5-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]thiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc(NCCCc2cn[nH]c2C)cc1N |
| InChI | InChI=1S/C13H19N5OS/c1-8-9(7-17-18-8)4-3-5-16-11-6-10(14)12(20-11)13(19)15-2/h6-7,16H,3-5,14H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | WUMKDVMIYBDOAL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|