C13H18F3N3OS — CID 103505983
3-amino-4-cyclopropyl-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide (PubChem CID 103505983) has the molecular formula C13H18F3N3OS and a molecular weight of 321.37 g/mol. Its IUPAC name is 3-amino-4-cyclopropyl-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyclopropyl-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103505983 |
| Molecular Formula | C13H18F3N3OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-amino-4-cyclopropyl-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc(NCCCC(F)(F)F)c(C2CC2)c1N |
| InChI | InChI=1S/C13H18F3N3OS/c1-18-11(20)10-9(17)8(7-3-4-7)12(21-10)19-6-2-5-13(14,15)16/h7,19H,2-6,17H2,1H3,(H,18,20) |
| InChIKey | QOOHUZVVGSCSQH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|