C12H15F3N4OS — CID 103506020
3-amino-4-cyano-N-methyl-5-(5,5,5-trifluoropentylamino)thiophene-2-carboxamide (PubChem CID 103506020) has the molecular formula C12H15F3N4OS and a molecular weight of 320.34 g/mol. Its IUPAC name is 3-amino-4-cyano-N-methyl-5-(5,5,5-trifluoropentylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyano-N-methyl-5-(5,5,5-trifluoropentylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103506020 |
| Molecular Formula | C12H15F3N4OS |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-amino-4-cyano-N-methyl-5-(5,5,5-trifluoropentylamino)thiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc(NCCCCC(F)(F)F)c(C#N)c1N |
| InChI | InChI=1S/C12H15F3N4OS/c1-18-10(20)9-8(17)7(6-16)11(21-9)19-5-3-2-4-12(13,14)15/h19H,2-5,17H2,1H3,(H,18,20) |
| InChIKey | GDYPNTDZKDLQSF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|