C12H17F3N2OS2 — CID 103506026
1-[3-amino-4-methylsulfanyl-5-(5,5,5-trifluoropentylamino)thiophen-2-yl]ethanone (PubChem CID 103506026) has the molecular formula C12H17F3N2OS2 and a molecular weight of 326.41 g/mol. Its IUPAC name is 1-[3-amino-4-methylsulfanyl-5-(5,5,5-trifluoropentylamino)thiophen-2-yl]ethanone.
| Compound Name | 1-[3-amino-4-methylsulfanyl-5-(5,5,5-trifluoropentylamino)thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 103506026 |
| Molecular Formula | C12H17F3N2OS2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1-[3-amino-4-methylsulfanyl-5-(5,5,5-trifluoropentylamino)thiophen-2-yl]ethanone |
| SMILES | CSc1c(NCCCCC(F)(F)F)sc(C(C)=O)c1N |
| InChI | InChI=1S/C12H17F3N2OS2/c1-7(18)9-8(16)10(19-2)11(20-9)17-6-4-3-5-12(13,14)15/h17H,3-6,16H2,1-2H3 |
| InChIKey | PPLNTMGGJZWPEG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|