C13H16F3N3OS — CID 103506050
4-amino-5-propanoyl-2-(5,5,5-trifluoropentylamino)thiophene-3-carbonitrile (PubChem CID 103506050) has the molecular formula C13H16F3N3OS and a molecular weight of 319.35 g/mol. Its IUPAC name is 4-amino-5-propanoyl-2-(5,5,5-trifluoropentylamino)thiophene-3-carbonitrile.
| Compound Name | 4-amino-5-propanoyl-2-(5,5,5-trifluoropentylamino)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 103506050 |
| Molecular Formula | C13H16F3N3OS |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-amino-5-propanoyl-2-(5,5,5-trifluoropentylamino)thiophene-3-carbonitrile |
| SMILES | CCC(=O)c1sc(NCCCCC(F)(F)F)c(C#N)c1N |
| InChI | InChI=1S/C13H16F3N3OS/c1-2-9(20)11-10(18)8(7-17)12(21-11)19-6-4-3-5-13(14,15)16/h19H,2-6,18H2,1H3 |
| InChIKey | HGZWAUOITAVNOO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|