C11H13F3N4OS — CID 103505953
3-amino-4-cyano-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide (PubChem CID 103505953) has the molecular formula C11H13F3N4OS and a molecular weight of 306.31 g/mol. Its IUPAC name is 3-amino-4-cyano-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyano-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103505953 |
| Molecular Formula | C11H13F3N4OS |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-amino-4-cyano-N-methyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc(NCCCC(F)(F)F)c(C#N)c1N |
| InChI | InChI=1S/C11H13F3N4OS/c1-17-9(19)8-7(16)6(5-15)10(20-8)18-4-2-3-11(12,13)14/h18H,2-4,16H2,1H3,(H,17,19) |
| InChIKey | NVUWCZYWTMGSCA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|