C12H17F3N2OS — CID 103506034
1-[3-amino-5-(5,5,5-trifluoropentylamino)thiophen-2-yl]propan-1-one (PubChem CID 103506034) has the molecular formula C12H17F3N2OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 1-[3-amino-5-(5,5,5-trifluoropentylamino)thiophen-2-yl]propan-1-one.
| Compound Name | 1-[3-amino-5-(5,5,5-trifluoropentylamino)thiophen-2-yl]propan-1-one |
|---|---|
| PubChem CID | 103506034 |
| Molecular Formula | C12H17F3N2OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-[3-amino-5-(5,5,5-trifluoropentylamino)thiophen-2-yl]propan-1-one |
| SMILES | CCC(=O)c1sc(NCCCCC(F)(F)F)cc1N |
| InChI | InChI=1S/C12H17F3N2OS/c1-2-9(18)11-8(16)7-10(19-11)17-6-4-3-5-12(13,14)15/h7,17H,2-6,16H2,1H3 |
| InChIKey | KQJAKJZPIYKIMH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|