C8H11FN2OS — CID 130505186
1-[3-amino-5-(2-fluoroethylamino)thiophen-2-yl]ethanone (PubChem CID 130505186) has the molecular formula C8H11FN2OS and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-[3-amino-5-(2-fluoroethylamino)thiophen-2-yl]ethanone.
| Compound Name | 1-[3-amino-5-(2-fluoroethylamino)thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 130505186 |
| Molecular Formula | C8H11FN2OS |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 1-[3-amino-5-(2-fluoroethylamino)thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1sc(NCCF)cc1N |
| InChI | InChI=1S/C8H11FN2OS/c1-5(12)8-6(10)4-7(13-8)11-3-2-9/h4,11H,2-3,10H2,1H3 |
| InChIKey | LATKWFCVQQZWIF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |