C12H18F3N3OS — CID 103505955
3-amino-N-propyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide (PubChem CID 103505955) has the molecular formula C12H18F3N3OS and a molecular weight of 309.36 g/mol. Its IUPAC name is 3-amino-N-propyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-propyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103505955 |
| Molecular Formula | C12H18F3N3OS |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-amino-N-propyl-5-(4,4,4-trifluorobutylamino)thiophene-2-carboxamide |
| SMILES | CCCNC(=O)c1sc(NCCCC(F)(F)F)cc1N |
| InChI | InChI=1S/C12H18F3N3OS/c1-2-5-18-11(19)10-8(16)7-9(20-10)17-6-3-4-12(13,14)15/h7,17H,2-6,16H2,1H3,(H,18,19) |
| InChIKey | UECKAZYQORNKQL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|