C15H20N4OS — CID 103526426
3-amino-5-[(3-methyl-2-pyridinyl)methylamino]-N-propylthiophene-2-carboxamide (PubChem CID 103526426) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-amino-5-[(3-methyl-2-pyridinyl)methylamino]-N-propylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[(3-methyl-2-pyridinyl)methylamino]-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103526426 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-amino-5-[(3-methyl-2-pyridinyl)methylamino]-N-propylthiophene-2-carboxamide |
| SMILES | CCCNC(=O)c1sc(NCc2ncccc2C)cc1N |
| InChI | InChI=1S/C15H20N4OS/c1-3-6-18-15(20)14-11(16)8-13(21-14)19-9-12-10(2)5-4-7-17-12/h4-5,7-8,19H,3,6,9,16H2,1-2H3,(H,18,20) |
| InChIKey | GCAXXKZJSFQQMN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |