C9H14N2OS2 — CID 103526738
3-amino-5-methylsulfanyl-N-propylthiophene-2-carboxamide (PubChem CID 103526738) has the molecular formula C9H14N2OS2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 3-amino-5-methylsulfanyl-N-propylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-methylsulfanyl-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103526738 |
| Molecular Formula | C9H14N2OS2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 3-amino-5-methylsulfanyl-N-propylthiophene-2-carboxamide |
| SMILES | CCCNC(=O)c1sc(SC)cc1N |
| InChI | InChI=1S/C9H14N2OS2/c1-3-4-11-9(12)8-6(10)5-7(13-2)14-8/h5H,3-4,10H2,1-2H3,(H,11,12) |
| InChIKey | CEJOKVAAUADZCR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |