C11H19NOS2Si — CID 12039968
N-ethyl-5-methylsulfanyl-3-trimethylsilylthiophene-2-carboxamide (PubChem CID 12039968) has the molecular formula C11H19NOS2Si and a molecular weight of 273.50 g/mol. Its IUPAC name is N-ethyl-5-methylsulfanyl-3-trimethylsilylthiophene-2-carboxamide.
| Compound Name | N-ethyl-5-methylsulfanyl-3-trimethylsilylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 12039968 |
| Molecular Formula | C11H19NOS2Si |
| Molecular Weight | 273.50 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-ethyl-5-methylsulfanyl-3-trimethylsilylthiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc(SC)cc1[Si](C)(C)C |
| InChI | InChI=1S/C11H19NOS2Si/c1-6-12-11(13)10-8(16(3,4)5)7-9(14-2)15-10/h7H,6H2,1-5H3,(H,12,13) |
| InChIKey | ODQGKHQAAZNJKD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|